C24H32F3N4O7S- — CID 172975118
(4R)-2-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]-4-methyl-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetate (PubChem CID 172975118) has the molecular formula C24H32F3N4O7S- and a molecular weight of 577.60 g/mol. Its IUPAC name is (4R)-2-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]-4-methyl-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetate.
| Compound Name | (4R)-2-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]-4-methyl-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 172975118 |
| Molecular Formula | C24H32F3N4O7S- |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.19 |
| IUPAC Name | (4R)-2-[(E)-N-(3-aminopropoxy)-C-methylcarbonimidoyl]-4-methyl-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetate |
| SMILES | C=CCOc1cc([C@@H](CCC)NC(=O)[C@]2(C)CSC(/C(C)=N/OCCCN)=N2)oc(=O)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C22H32N4O5S.C2HF3O2/c1-5-8-17(18-12-16(29-10-6-2)13-19(27)31-18)24-21(28)22(4)14-32-20(25-22)15(3)26-30-11-7-9-23;3-2(4,5)1(6)7/h6,12-13,17H,2,5,7-11,14,23H2,1,3-4H3,(H,24,28);(H,6,7)/p-1/b26-15+;/t17-,22+;/m1./s1 |
| InChIKey | PNOMYISVSKLIDY-WLUXHIKGSA-M |
| XLogP | 2.11 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|