C18H35NO2Y-2 — CID 172975413
4-methanidyl-2,2,6,6-tetramethylheptan-3-one;(E)-N-propoxypropan-1-imine;yttrium (PubChem CID 172975413) has the molecular formula C18H35NO2Y-2 and a molecular weight of 386.39 g/mol. Its IUPAC name is 4-methanidyl-2,2,6,6-tetramethylheptan-3-one;(E)-N-propoxypropan-1-imine;yttrium.
| Compound Name | 4-methanidyl-2,2,6,6-tetramethylheptan-3-one;(E)-N-propoxypropan-1-imine;yttrium |
|---|---|
| PubChem CID | 172975413 |
| Molecular Formula | C18H35NO2Y-2 |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-methanidyl-2,2,6,6-tetramethylheptan-3-one;(E)-N-propoxypropan-1-imine;yttrium |
| SMILES | [CH2-]C(CC(C)(C)C)C(=O)C(C)(C)C.[CH2-]CCO/N=C/CC.[Y] |
| InChI | InChI=1S/C12H23O.C6H12NO.Y/c1-9(8-11(2,3)4)10(13)12(5,6)7;1-3-5-7-8-6-4-2;/h9H,1,8H2,2-7H3;5H,2-4,6H2,1H3;/q2*-1;/b;7-5+; |
| InChIKey | LAZMSABIJIJUGZ-QVSSGMAGSA-N |
| XLogP | 5.11 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|