C16H12ClN5O2S — CID 172977548
5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-2-(4-chlorophenyl)sulfanylbenzoic acid (PubChem CID 172977548) has the molecular formula C16H12ClN5O2S and a molecular weight of 373.83 g/mol. Its IUPAC name is 5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-2-(4-chlorophenyl)sulfanylbenzoic acid.
| Compound Name | 5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-2-(4-chlorophenyl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 172977548 |
| Molecular Formula | C16H12ClN5O2S |
| Molecular Weight | 373.83 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 5-[(2Z)-2-(2-amino-1-cyano-2-iminoethylidene)hydrazinyl]-2-(4-chlorophenyl)sulfanylbenzoic acid |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(Sc2ccc(Cl)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H12ClN5O2S/c17-9-1-4-11(5-2-9)25-14-6-3-10(7-12(14)16(23)24)21-22-13(8-18)15(19)20/h1-7,21H,(H3,19,20)(H,23,24)/b22-13+ |
| InChIKey | IJQHTKHWEOEULA-LPYMAVHISA-N |
| XLogP | 3.42 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|