C13H14N6S — CID 172979631
(1Z)-2-amino-2-imino-N-[(2-propyl-1,3-benzothiazol-6-yl)amino]ethanimidoyl cyanide (PubChem CID 172979631) has the molecular formula C13H14N6S and a molecular weight of 286.36 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[(2-propyl-1,3-benzothiazol-6-yl)amino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[(2-propyl-1,3-benzothiazol-6-yl)amino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979631 |
| Molecular Formula | C13H14N6S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[(2-propyl-1,3-benzothiazol-6-yl)amino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc2nc(CCC)sc2c1 |
| InChI | InChI=1S/C13H14N6S/c1-2-3-12-17-9-5-4-8(6-11(9)20-12)18-19-10(7-14)13(15)16/h4-6,18H,2-3H2,1H3,(H3,15,16)/b19-10+ |
| InChIKey | CCGFVPKYFCEIMN-VXLYETTFSA-N |
| XLogP | 2.48 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|