C14H13N7S — CID 172980350
(1Z)-2-amino-N-[4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172980350) has the molecular formula C14H13N7S and a molecular weight of 311.37 g/mol. Its IUPAC name is (1Z)-2-amino-N-[4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172980350 |
| Molecular Formula | C14H13N7S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (1Z)-2-amino-N-[4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(C2=CSC3=NCCN23)cc1 |
| InChI | InChI=1S/C14H13N7S/c15-7-11(13(16)17)20-19-10-3-1-9(2-4-10)12-8-22-14-18-5-6-21(12)14/h1-4,8,19H,5-6H2,(H3,16,17)/b20-11+ |
| InChIKey | YNNPBVBOUIIGEE-RGVLZGJSSA-N |
| XLogP | 1.63 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|