C21H15Cl2N5O2S — CID 172980681
[1-(2,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(E)-quinolin-4-ylmethylideneamino]carbamimidothioate (PubChem CID 172980681) has the molecular formula C21H15Cl2N5O2S and a molecular weight of 472.36 g/mol. Its IUPAC name is [1-(2,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(E)-quinolin-4-ylmethylideneamino]carbamimidothioate.
| Compound Name | [1-(2,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(E)-quinolin-4-ylmethylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 172980681 |
| Molecular Formula | C21H15Cl2N5O2S |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | [1-(2,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(E)-quinolin-4-ylmethylideneamino]carbamimidothioate |
| SMILES | NC(=N/N=C/c1ccnc2ccccc12)SC1CC(=O)N(c2cc(Cl)ccc2Cl)C1=O |
| InChI | InChI=1S/C21H15Cl2N5O2S/c22-13-5-6-15(23)17(9-13)28-19(29)10-18(20(28)30)31-21(24)27-26-11-12-7-8-25-16-4-2-1-3-14(12)16/h1-9,11,18H,10H2,(H2,24,27)/b26-11+ |
| InChIKey | JTJFQQCFFAYSEE-KBKYJPHKSA-N |
| XLogP | 4.26 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|