C26H36N6O6S — CID 172981549
(2-butan-2-ylphenyl) N-methylcarbamate;methyl N-(1H-benzimidazol-2-yl)carbamate;methyl (1E)-N-(methylcarbamoyloxy)ethanimidothioate (PubChem CID 172981549) has the molecular formula C26H36N6O6S and a molecular weight of 560.68 g/mol. Its IUPAC name is (2-butan-2-ylphenyl) N-methylcarbamate;methyl N-(1H-benzimidazol-2-yl)carbamate;methyl (1E)-N-(methylcarbamoyloxy)ethanimidothioate.
| Compound Name | (2-butan-2-ylphenyl) N-methylcarbamate;methyl N-(1H-benzimidazol-2-yl)carbamate;methyl (1E)-N-(methylcarbamoyloxy)ethanimidothioate |
|---|---|
| PubChem CID | 172981549 |
| Molecular Formula | C26H36N6O6S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | (2-butan-2-ylphenyl) N-methylcarbamate;methyl N-(1H-benzimidazol-2-yl)carbamate;methyl (1E)-N-(methylcarbamoyloxy)ethanimidothioate |
| SMILES | CCC(C)c1ccccc1OC(=O)NC.CNC(=O)O/N=C(\C)SC.COC(=O)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H17NO2.C9H9N3O2.C5H10N2O2S/c1-4-9(2)10-7-5-6-8-11(10)15-12(14)13-3;1-14-9(13)12-8-10-6-4-2-3-5-7(6)11-8;1-4(10-3)7-9-5(8)6-2/h5-9H,4H2,1-3H3,(H,13,14);2-5H,1H3,(H2,10,11,12,13);1-3H3,(H,6,8)/b;;7-4+ |
| InChIKey | WNSMFNPWDMWILU-NSBWIVAZSA-N |
| XLogP | 5.70 |
| TPSA | 156.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|