About (2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine
(2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine (PubChem CID 172982352) has the molecular formula C8H14Br2N2O7
and a molecular weight of 410.02 g/mol. Its IUPAC name is (2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine.
Molecular Properties
| Compound Name | (2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine |
| PubChem CID | 172982352 |
| Molecular Formula | C8H14Br2N2O7 |
| Molecular Weight | 410.02 g/mol |
| Exact Mass | 407.92 |
| IUPAC Name | (2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine |
| SMILES | CO/N=C(/CBr)C(=O)O.CON.O=C(O)C(=O)CBr |
| InChI | InChI=1S/C4H6BrNO3.C3H3BrO3.CH5NO/c1-9-6-3(2-5)4(7)8;4-1-2(5)3(6)7;1-3-2/h2H2,1H3,(H,7,8);1H2,(H,6,7);2H2,1H3/b6-3-;; |
| InChIKey | FXUQNMKUIAGZKJ-OBEZLJEISA-N |
| XLogP | 0.01 |
| TPSA | 148.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.02 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine?
The IUPAC name of (2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine (CID 172982352) is (2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine.
What is the SMILES notation for (2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine?
The canonical SMILES for (2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine is CO/N=C(/CBr)C(=O)O.CON.O=C(O)C(=O)CBr.
What is the InChIKey of (2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine?
The InChIKey is FXUQNMKUIAGZKJ-OBEZLJEISA-N. The full InChI is InChI=1S/C4H6BrNO3.C3H3BrO3.CH5NO/c1-9-6-3(2-5)4(7)8;4-1-2(5)3(6)7;1-3-2/h2H2,1H3,(H,7,8);1H2,(H,6,7);2H2,1H3/b6-3-;;.
What are the key properties of (2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine?
(2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine has a molecular weight of 410.02 g/mol, XLogP of 0.01, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3-bromo-2-methoxyiminopropanoic acid;3-bromo-2-oxopropanoic acid;O-methylhydroxylamine is sourced from PubChem (CID 172982352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).