About (E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine
(E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine (PubChem CID 172983284) has the molecular formula C13H17FN2O
and a molecular weight of 236.29 g/mol. Its IUPAC name is (E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine.
Molecular Properties
| Compound Name | (E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine |
| PubChem CID | 172983284 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine |
| SMILES | CC(C)(C)O/N=C/C=N/Cc1cccc(F)c1 |
| InChI | InChI=1S/C13H17FN2O/c1-13(2,3)17-16-8-7-15-10-11-5-4-6-12(14)9-11/h4-9H,10H2,1-3H3/b15-7+,16-8+ |
| InChIKey | ZUZGUGZVPVVQSS-BGPOSVGRSA-N |
| XLogP | 3.20 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine?
The IUPAC name of (E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine (CID 172983284) is (E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine.
What is the SMILES notation for (E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine?
The canonical SMILES for (E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine is CC(C)(C)O/N=C/C=N/Cc1cccc(F)c1.
What is the InChIKey of (E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine?
The InChIKey is ZUZGUGZVPVVQSS-BGPOSVGRSA-N. The full InChI is InChI=1S/C13H17FN2O/c1-13(2,3)17-16-8-7-15-10-11-5-4-6-12(14)9-11/h4-9H,10H2,1-3H3/b15-7+,16-8+.
What are the key properties of (E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine?
(E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine has a molecular weight of 236.29 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(3-fluorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxy]ethane-1,2-diimine is sourced from PubChem (CID 172983284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).