About lanthanum;oxalate;nonahydrate
lanthanum;oxalate;nonahydrate (PubChem CID 172983604) has the molecular formula C2H18LaO13-2
and a molecular weight of 389.06 g/mol. Its IUPAC name is lanthanum;oxalate;nonahydrate.
Molecular Properties
| Compound Name | lanthanum;oxalate;nonahydrate |
| PubChem CID | 172983604 |
| Molecular Formula | C2H18LaO13-2 |
| Molecular Weight | 389.06 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | lanthanum;oxalate;nonahydrate |
| SMILES | O.O.O.O.O.O.O.O.O.O=C([O-])C(=O)[O-].[La] |
| InChI | InChI=1S/C2H2O4.La.9H2O/c3-1(4)2(5)6;;;;;;;;;;/h(H,3,4)(H,5,6);;9*1H2/p-2 |
| InChIKey | CZJARIBSJQUBAV-UHFFFAOYSA-L |
| XLogP | -10.94 |
| TPSA | 363.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.06 |
| LogP ≤ 5 | -10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze lanthanum;oxalate;nonahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lanthanum;oxalate;nonahydrate?
The IUPAC name of lanthanum;oxalate;nonahydrate (CID 172983604) is lanthanum;oxalate;nonahydrate.
What is the SMILES notation for lanthanum;oxalate;nonahydrate?
The canonical SMILES for lanthanum;oxalate;nonahydrate is O.O.O.O.O.O.O.O.O.O=C([O-])C(=O)[O-].[La].
What is the InChIKey of lanthanum;oxalate;nonahydrate?
The InChIKey is CZJARIBSJQUBAV-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.La.9H2O/c3-1(4)2(5)6;;;;;;;;;;/h(H,3,4)(H,5,6);;9*1H2/p-2.
What are the key properties of lanthanum;oxalate;nonahydrate?
lanthanum;oxalate;nonahydrate has a molecular weight of 389.06 g/mol, XLogP of -10.94, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lanthanum;oxalate;nonahydrate is sourced from PubChem (CID 172983604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).