C12H10N4O5S — CID 172983981
2-[2-[(E)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 172983981) has the molecular formula C12H10N4O5S and a molecular weight of 322.30 g/mol. Its IUPAC name is 2-[2-[(E)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[(E)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 172983981 |
| Molecular Formula | C12H10N4O5S |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-[2-[(E)-(4-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=N/N=C/c2ccc([N+](=O)[O-])cc2)NC1=O |
| InChI | InChI=1S/C12H10N4O5S/c17-10(18)5-9-11(19)14-12(22-9)15-13-6-7-1-3-8(4-2-7)16(20)21/h1-4,6,9H,5H2,(H,17,18)(H,14,15,19)/b13-6+ |
| InChIKey | WXFJOEFIIUKNOS-AWNIVKPZSA-N |
| XLogP | 0.99 |
| TPSA | 134.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|