C23H29ClN6O2 — CID 172984452
(E)-N-[(6-chloro-3-pyridinyl)methoxy]butan-2-imine;(E)-N-[(6-pyrazol-1-yl-3-pyridinyl)methoxy]butan-2-imine (PubChem CID 172984452) has the molecular formula C23H29ClN6O2 and a molecular weight of 456.98 g/mol. Its IUPAC name is (E)-N-[(6-chloro-3-pyridinyl)methoxy]butan-2-imine;(E)-N-[(6-pyrazol-1-yl-3-pyridinyl)methoxy]butan-2-imine.
| Compound Name | (E)-N-[(6-chloro-3-pyridinyl)methoxy]butan-2-imine;(E)-N-[(6-pyrazol-1-yl-3-pyridinyl)methoxy]butan-2-imine |
|---|---|
| PubChem CID | 172984452 |
| Molecular Formula | C23H29ClN6O2 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (E)-N-[(6-chloro-3-pyridinyl)methoxy]butan-2-imine;(E)-N-[(6-pyrazol-1-yl-3-pyridinyl)methoxy]butan-2-imine |
| SMILES | CC/C(C)=N/OCc1ccc(-n2cccn2)nc1.CC/C(C)=N/OCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H16N4O.C10H13ClN2O/c1-3-11(2)16-18-10-12-5-6-13(14-9-12)17-8-4-7-15-17;1-3-8(2)13-14-7-9-4-5-10(11)12-6-9/h4-9H,3,10H2,1-2H3;4-6H,3,7H2,1-2H3/b16-11+;13-8+ |
| InChIKey | HGVLAQXJNUQIHX-LKWPPOQZSA-N |
| XLogP | 5.61 |
| TPSA | 86.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|