C26H42N8O3S2 — CID 172984511
2-amino-1-(2-ethylsulfanylethoxy)guanidine;1-(2-ethylsulfanylethoxy)-2-[(E)-(2-methylphenyl)methylideneamino]guanidine;2-methylbenzaldehyde (PubChem CID 172984511) has the molecular formula C26H42N8O3S2 and a molecular weight of 578.81 g/mol. Its IUPAC name is 2-amino-1-(2-ethylsulfanylethoxy)guanidine;1-(2-ethylsulfanylethoxy)-2-[(E)-(2-methylphenyl)methylideneamino]guanidine;2-methylbenzaldehyde.
| Compound Name | 2-amino-1-(2-ethylsulfanylethoxy)guanidine;1-(2-ethylsulfanylethoxy)-2-[(E)-(2-methylphenyl)methylideneamino]guanidine;2-methylbenzaldehyde |
|---|---|
| PubChem CID | 172984511 |
| Molecular Formula | C26H42N8O3S2 |
| Molecular Weight | 578.81 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | 2-amino-1-(2-ethylsulfanylethoxy)guanidine;1-(2-ethylsulfanylethoxy)-2-[(E)-(2-methylphenyl)methylideneamino]guanidine;2-methylbenzaldehyde |
| SMILES | CCSCCONC(N)=N/N=C/c1ccccc1C.CCSCCONC(N)=NN.Cc1ccccc1C=O |
| InChI | InChI=1S/C13H20N4OS.C8H8O.C5H14N4OS/c1-3-19-9-8-18-17-13(14)16-15-10-12-7-5-4-6-11(12)2;1-7-4-2-3-5-8(7)6-9;1-2-11-4-3-10-9-5(6)8-7/h4-7,10H,3,8-9H2,1-2H3,(H3,14,16,17);2-6H,1H3;2-4,7H2,1H3,(H3,6,8,9)/b15-10+;; |
| InChIKey | HHSSEWIGIYVMCQ-OVWKBUNZSA-N |
| XLogP | 3.17 |
| TPSA | 174.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.81 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|