C16H16N2O3 — CID 172985978
(4Z)-4-hydroxyimino-2-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]-2,3-dihydro-1-benzoxepin-5-one (PubChem CID 172985978) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is (4Z)-4-hydroxyimino-2-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]-2,3-dihydro-1-benzoxepin-5-one.
| Compound Name | (4Z)-4-hydroxyimino-2-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]-2,3-dihydro-1-benzoxepin-5-one |
|---|---|
| PubChem CID | 172985978 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (4Z)-4-hydroxyimino-2-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]-2,3-dihydro-1-benzoxepin-5-one |
| SMILES | C=N/C=C\C(=C/C)C1C/C(=N/O)C(=O)c2ccccc2O1 |
| InChI | InChI=1S/C16H16N2O3/c1-3-11(8-9-17-2)15-10-13(18-20)16(19)12-6-4-5-7-14(12)21-15/h3-9,15,20H,2,10H2,1H3/b9-8-,11-3+,18-13- |
| InChIKey | WQBCUXIVSIWMLI-WEMMARGBSA-N |
| XLogP | 3.01 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|