About (E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine
(E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine (PubChem CID 172986240) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is (E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine.
Molecular Properties
| Compound Name | (E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine |
| PubChem CID | 172986240 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | (E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine |
| SMILES | CN1C=CCC/C1=N\N |
| InChI | InChI=1S/C6H11N3/c1-9-5-3-2-4-6(9)8-7/h3,5H,2,4,7H2,1H3/b8-6+ |
| InChIKey | RVSLAFNZTIQVCX-SOFGYWHQSA-N |
| XLogP | 0.50 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine?
The IUPAC name of (E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine (CID 172986240) is (E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine.
What is the SMILES notation for (E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine?
The canonical SMILES for (E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine is CN1C=CCC/C1=N\N.
What is the InChIKey of (E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine?
The InChIKey is RVSLAFNZTIQVCX-SOFGYWHQSA-N. The full InChI is InChI=1S/C6H11N3/c1-9-5-3-2-4-6(9)8-7/h3,5H,2,4,7H2,1H3/b8-6+.
What are the key properties of (E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine?
(E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine has a molecular weight of 125.17 g/mol, XLogP of 0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-(1-methyl-3,4-dihydropyridin-2-ylidene)hydrazine is sourced from PubChem (CID 172986240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).