About iodo (1Z)-N-imino-2-methylpropanehydrazonate
iodo (1Z)-N-imino-2-methylpropanehydrazonate (PubChem CID 172986392) has the molecular formula C4H8IN3O
and a molecular weight of 241.03 g/mol. Its IUPAC name is iodo (1Z)-N-imino-2-methylpropanehydrazonate.
Molecular Properties
| Compound Name | iodo (1Z)-N-imino-2-methylpropanehydrazonate |
| PubChem CID | 172986392 |
| Molecular Formula | C4H8IN3O |
| Molecular Weight | 241.03 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | iodo (1Z)-N-imino-2-methylpropanehydrazonate |
| SMILES | [H]/N=N/N=C(\OI)C(C)C |
| InChI | InChI=1S/C4H8IN3O/c1-3(2)4(9-5)7-8-6/h3,6H,1-2H3/b7-4-,8-6+ |
| InChIKey | WEYSBUVADPZCBP-ZJLRGQKUSA-N |
| XLogP | 2.35 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.03 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodo (1Z)-N-imino-2-methylpropanehydrazonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodo (1Z)-N-imino-2-methylpropanehydrazonate?
The IUPAC name of iodo (1Z)-N-imino-2-methylpropanehydrazonate (CID 172986392) is iodo (1Z)-N-imino-2-methylpropanehydrazonate.
What is the SMILES notation for iodo (1Z)-N-imino-2-methylpropanehydrazonate?
The canonical SMILES for iodo (1Z)-N-imino-2-methylpropanehydrazonate is [H]/N=N/N=C(\OI)C(C)C.
What is the InChIKey of iodo (1Z)-N-imino-2-methylpropanehydrazonate?
The InChIKey is WEYSBUVADPZCBP-ZJLRGQKUSA-N. The full InChI is InChI=1S/C4H8IN3O/c1-3(2)4(9-5)7-8-6/h3,6H,1-2H3/b7-4-,8-6+.
What are the key properties of iodo (1Z)-N-imino-2-methylpropanehydrazonate?
iodo (1Z)-N-imino-2-methylpropanehydrazonate has a molecular weight of 241.03 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iodo (1Z)-N-imino-2-methylpropanehydrazonate is sourced from PubChem (CID 172986392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).