C17H20Br2N6O — CID 172986443
2-[(E)-[4-(1,7-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1-hydroxyguanidine;bromide;hydrobromide (PubChem CID 172986443) has the molecular formula C17H20Br2N6O and a molecular weight of 484.20 g/mol. Its IUPAC name is 2-[(E)-[4-(1,7-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1-hydroxyguanidine;bromide;hydrobromide.
| Compound Name | 2-[(E)-[4-(1,7-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1-hydroxyguanidine;bromide;hydrobromide |
|---|---|
| PubChem CID | 172986443 |
| Molecular Formula | C17H20Br2N6O |
| Molecular Weight | 484.20 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | 2-[(E)-[4-(1,7-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1-hydroxyguanidine;bromide;hydrobromide |
| SMILES | Br.Cc1cc[n+]2cc(-c3ccc(/C=N/N=C(N)NO)cc3)n(C)c2c1.[Br-] |
| InChI | InChI=1S/C17H19N6O.2BrH/c1-12-7-8-23-11-15(22(2)16(23)9-12)14-5-3-13(4-6-14)10-19-20-17(18)21-24;;/h3-11,24H,1-2H3,(H3,18,20,21);2*1H/q+1;;/p-1/b19-10+;; |
| InChIKey | XVKFXEBNNNNIGD-DLFBYYCRSA-M |
| XLogP | -1.05 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.20 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|