C18H26N2O3 — CID 172986482
(1E)-10-hydroxy-1-hydroxyimino-9a,11a-dimethyl-3,3a,3b,4,6,8,9,9b,10,11-decahydro-2H-indeno[5,4-f]quinolin-7-one (PubChem CID 172986482) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (1E)-10-hydroxy-1-hydroxyimino-9a,11a-dimethyl-3,3a,3b,4,6,8,9,9b,10,11-decahydro-2H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (1E)-10-hydroxy-1-hydroxyimino-9a,11a-dimethyl-3,3a,3b,4,6,8,9,9b,10,11-decahydro-2H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 172986482 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (1E)-10-hydroxy-1-hydroxyimino-9a,11a-dimethyl-3,3a,3b,4,6,8,9,9b,10,11-decahydro-2H-indeno[5,4-f]quinolin-7-one |
| SMILES | CC12CCC(=O)NC1=CCC1C2C(O)CC2(C)/C(=N/O)CCC12 |
| InChI | InChI=1S/C18H26N2O3/c1-17-8-7-15(22)19-13(17)5-3-10-11-4-6-14(20-23)18(11,2)9-12(21)16(10)17/h5,10-12,16,21,23H,3-4,6-9H2,1-2H3,(H,19,22)/b20-14+ |
| InChIKey | DAPUGDDJRMVBFJ-XSFVSMFZSA-N |
| XLogP | 2.43 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|