C29H41ClN2O6 — CID 172986871
ethyl 2-[(E)-[(2R,3R,4R)-3-[(1E,3E)-5-[5-chloro-2-hydroxy-3-(hydroxymethyliminomethyl)-6-methoxy-4-methylphenyl]-3-methylpenta-1,3-dienyl]-2,3,4-trimethylcyclohexylidene]amino]oxyacetate (PubChem CID 172986871) has the molecular formula C29H41ClN2O6 and a molecular weight of 549.11 g/mol. Its IUPAC name is ethyl 2-[(E)-[(2R,3R,4R)-3-[(1E,3E)-5-[5-chloro-2-hydroxy-3-(hydroxymethyliminomethyl)-6-methoxy-4-methylphenyl]-3-methylpenta-1,3-dienyl]-2,3,4-trimethylcyclohexylidene]amino]oxyacetate.
| Compound Name | ethyl 2-[(E)-[(2R,3R,4R)-3-[(1E,3E)-5-[5-chloro-2-hydroxy-3-(hydroxymethyliminomethyl)-6-methoxy-4-methylphenyl]-3-methylpenta-1,3-dienyl]-2,3,4-trimethylcyclohexylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 172986871 |
| Molecular Formula | C29H41ClN2O6 |
| Molecular Weight | 549.11 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | ethyl 2-[(E)-[(2R,3R,4R)-3-[(1E,3E)-5-[5-chloro-2-hydroxy-3-(hydroxymethyliminomethyl)-6-methoxy-4-methylphenyl]-3-methylpenta-1,3-dienyl]-2,3,4-trimethylcyclohexylidene]amino]oxyacetate |
| SMILES | CCOC(=O)CO/N=C1\CC[C@@H](C)[C@](C)(/C=C/C(C)=C/Cc2c(O)c(C=NCO)c(C)c(Cl)c2OC)[C@H]1C |
| InChI | InChI=1S/C29H41ClN2O6/c1-8-37-25(34)16-38-32-24-12-10-19(3)29(6,21(24)5)14-13-18(2)9-11-22-27(35)23(15-31-17-33)20(4)26(30)28(22)36-7/h9,13-15,19,21,33,35H,8,10-12,16-17H2,1-7H3/b14-13+,18-9+,31-15?,32-24+/t19-,21+,29+/m1/s1 |
| InChIKey | HJMRWNRDHPRETB-HOACYAKTSA-N |
| XLogP | 5.78 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.11 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|