C17H26N4O4 — CID 172990416
(2S)-1-[2-[[(5S,7R)-3-hydroxy-1-adamantyl]-nitrosoamino]acetyl]pyrrolidine-2-carboxamide (PubChem CID 172990416) has the molecular formula C17H26N4O4 and a molecular weight of 352.40 g/mol. Its IUPAC name is (2S)-1-[2-[[(5S,7R)-3-hydroxy-1-adamantyl]-nitrosoamino]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2-[[(5S,7R)-3-hydroxy-1-adamantyl]-nitrosoamino]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 172990416 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (2S)-1-[2-[[(5S,7R)-3-hydroxy-1-adamantyl]-nitrosoamino]acetyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN1[13C](=O)[13CH2]N(N=O)C12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C17H26N4O4/c18-15(23)13-2-1-3-20(13)14(22)9-21(19-25)16-5-11-4-12(6-16)8-17(24,7-11)10-16/h11-13,24H,1-10H2,(H2,18,23)/t11-,12+,13-,16?,17?/m0/s1/i9+1,14+1 |
| InChIKey | GRDQXZLCRCRZHJ-PVJBVMMPSA-N |
| XLogP | 0.53 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|