About 6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide
6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide (PubChem CID 172991036) has the molecular formula C17H14BrN3O
and a molecular weight of 356.22 g/mol. Its IUPAC name is 6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide.
Molecular Properties
| Compound Name | 6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide |
| PubChem CID | 172991036 |
| Molecular Formula | C17H14BrN3O |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CNC2)c1cc(Br)cc2[nH]ccc12 |
| InChI | InChI=1S/C17H14BrN3O/c18-12-6-15(14-3-4-20-16(14)7-12)17(22)21-13-2-1-10-8-19-9-11(10)5-13/h1-7,19-20H,8-9H2,(H,21,22) |
| InChIKey | BXMKAELKOMHUTP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide?
The IUPAC name of 6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide (CID 172991036) is 6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide.
What is the SMILES notation for 6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide?
The canonical SMILES for 6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide is O=C(Nc1ccc2c(c1)CNC2)c1cc(Br)cc2[nH]ccc12.
What is the InChIKey of 6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide?
The InChIKey is BXMKAELKOMHUTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrN3O/c18-12-6-15(14-3-4-20-16(14)7-12)17(22)21-13-2-1-10-8-19-9-11(10)5-13/h1-7,19-20H,8-9H2,(H,21,22).
What are the key properties of 6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide?
6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide has a molecular weight of 356.22 g/mol, XLogP of 3.79, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)-1H-indole-4-carboxamide is sourced from PubChem (CID 172991036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).