About 3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide
3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide (PubChem CID 172991037) has the molecular formula C19H15BrN2O
and a molecular weight of 367.25 g/mol. Its IUPAC name is 3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide.
Molecular Properties
| Compound Name | 3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide |
| PubChem CID | 172991037 |
| Molecular Formula | C19H15BrN2O |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CNC2)c1cc(Br)cc2ccccc12 |
| InChI | InChI=1S/C19H15BrN2O/c20-15-7-12-3-1-2-4-17(12)18(9-15)19(23)22-16-6-5-13-10-21-11-14(13)8-16/h1-9,21H,10-11H2,(H,22,23) |
| InChIKey | XJBLHUNGQLAOGU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide?
The IUPAC name of 3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide (CID 172991037) is 3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide.
What is the SMILES notation for 3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide?
The canonical SMILES for 3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide is O=C(Nc1ccc2c(c1)CNC2)c1cc(Br)cc2ccccc12.
What is the InChIKey of 3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide?
The InChIKey is XJBLHUNGQLAOGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15BrN2O/c20-15-7-12-3-1-2-4-17(12)18(9-15)19(23)22-16-6-5-13-10-21-11-14(13)8-16/h1-9,21H,10-11H2,(H,22,23).
What are the key properties of 3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide?
3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide has a molecular weight of 367.25 g/mol, XLogP of 4.46, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(2,3-dihydro-1H-isoindol-5-yl)naphthalene-1-carboxamide is sourced from PubChem (CID 172991037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).