C28H58N2O6P+ — CID 172991103
2-[hydroxy-[(Z,2S,3R)-3-hydroxy-2-(undecanoylamino)dodec-4-enoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 172991103) has the molecular formula C28H58N2O6P+ and a molecular weight of 549.75 g/mol. Its IUPAC name is 2-[hydroxy-[(Z,2S,3R)-3-hydroxy-2-(undecanoylamino)dodec-4-enoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(Z,2S,3R)-3-hydroxy-2-(undecanoylamino)dodec-4-enoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 172991103 |
| Molecular Formula | C28H58N2O6P+ |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.40 |
| IUPAC Name | 2-[hydroxy-[(Z,2S,3R)-3-hydroxy-2-(undecanoylamino)dodec-4-enoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCC/C=C\[C@@H](O)[C@H](COP(=O)(O)OCC[N+](C)(C)C)NC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C28H57N2O6P/c1-6-8-10-12-14-16-18-20-22-28(32)29-26(27(31)21-19-17-15-13-11-9-7-2)25-36-37(33,34)35-24-23-30(3,4)5/h19,21,26-27,31H,6-18,20,22-25H2,1-5H3,(H-,29,32,33,34)/p+1/b21-19-/t26-,27+/m0/s1 |
| InChIKey | ZJKLFAWECUHPRK-TVCSTCRHSA-O |
| XLogP | 6.12 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|