C22H29N3O8S — CID 172991164
(3R,4R,5S)-5-[(1S,2R)-1-carboxy-2-hydroxypropyl]-3-[(3S,5S)-5-[(3-carboxyphenyl)carbamoyl]pyrrolidin-3-yl]sulfanyl-4-methylpyrrolidine-2-carboxylic acid (PubChem CID 172991164) has the molecular formula C22H29N3O8S and a molecular weight of 495.55 g/mol. Its IUPAC name is (3R,4R,5S)-5-[(1S,2R)-1-carboxy-2-hydroxypropyl]-3-[(3S,5S)-5-[(3-carboxyphenyl)carbamoyl]pyrrolidin-3-yl]sulfanyl-4-methylpyrrolidine-2-carboxylic acid.
| Compound Name | (3R,4R,5S)-5-[(1S,2R)-1-carboxy-2-hydroxypropyl]-3-[(3S,5S)-5-[(3-carboxyphenyl)carbamoyl]pyrrolidin-3-yl]sulfanyl-4-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 172991164 |
| Molecular Formula | C22H29N3O8S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (3R,4R,5S)-5-[(1S,2R)-1-carboxy-2-hydroxypropyl]-3-[(3S,5S)-5-[(3-carboxyphenyl)carbamoyl]pyrrolidin-3-yl]sulfanyl-4-methylpyrrolidine-2-carboxylic acid |
| SMILES | C[C@@H]1[C@H]([C@H](C(=O)O)[C@@H](C)O)NC(C(=O)O)[C@@H]1S[C@@H]1CN[C@H](C(=O)Nc2cccc(C(=O)O)c2)C1 |
| InChI | InChI=1S/C22H29N3O8S/c1-9-16(15(10(2)26)21(30)31)25-17(22(32)33)18(9)34-13-7-14(23-8-13)19(27)24-12-5-3-4-11(6-12)20(28)29/h3-6,9-10,13-18,23,25-26H,7-8H2,1-2H3,(H,24,27)(H,28,29)(H,30,31)(H,32,33)/t9-,10-,13+,14+,15-,16-,17?,18-/m1/s1 |
| InChIKey | ULDBZJHSYHODSQ-RVZPRYQNSA-N |
| XLogP | 0.30 |
| TPSA | 185.29 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |