C24H17ClN4O4 — CID 172991828
N-(4-chlorophenyl)-2-[2-[(E)-2-(3-nitrophenyl)ethenyl]-4-oxoquinazolin-3-yl]acetamide (PubChem CID 172991828) has the molecular formula C24H17ClN4O4 and a molecular weight of 460.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-[(E)-2-(3-nitrophenyl)ethenyl]-4-oxoquinazolin-3-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-[(E)-2-(3-nitrophenyl)ethenyl]-4-oxoquinazolin-3-yl]acetamide |
|---|---|
| PubChem CID | 172991828 |
| Molecular Formula | C24H17ClN4O4 |
| Molecular Weight | 460.88 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-[(E)-2-(3-nitrophenyl)ethenyl]-4-oxoquinazolin-3-yl]acetamide |
| SMILES | O=C(Cn1c(/C=C/c2cccc([N+](=O)[O-])c2)nc2ccccc2c1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17ClN4O4/c25-17-9-11-18(12-10-17)26-23(30)15-28-22(27-21-7-2-1-6-20(21)24(28)31)13-8-16-4-3-5-19(14-16)29(32)33/h1-14H,15H2,(H,26,30)/b13-8+ |
| InChIKey | ZALJFEIZPQVYHK-MDWZMJQESA-N |
| XLogP | 4.77 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|