C16H10N6O2 — CID 172991944
11-methyl-5,6-dioxo-13-phenyl-1,2,4,7,8-pentazatricyclo[7.4.0.03,7]trideca-2,8,10,12-tetraene-10-carbonitrile (PubChem CID 172991944) has the molecular formula C16H10N6O2 and a molecular weight of 318.30 g/mol. Its IUPAC name is 11-methyl-5,6-dioxo-13-phenyl-1,2,4,7,8-pentazatricyclo[7.4.0.03,7]trideca-2,8,10,12-tetraene-10-carbonitrile.
| Compound Name | 11-methyl-5,6-dioxo-13-phenyl-1,2,4,7,8-pentazatricyclo[7.4.0.03,7]trideca-2,8,10,12-tetraene-10-carbonitrile |
|---|---|
| PubChem CID | 172991944 |
| Molecular Formula | C16H10N6O2 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 11-methyl-5,6-dioxo-13-phenyl-1,2,4,7,8-pentazatricyclo[7.4.0.03,7]trideca-2,8,10,12-tetraene-10-carbonitrile |
| SMILES | Cc1cc(-c2ccccc2)n2nc3[nH]c(=O)c(=O)n-3nc2c1C#N |
| InChI | InChI=1S/C16H10N6O2/c1-9-7-12(10-5-3-2-4-6-10)21-13(11(9)8-17)19-22-15(24)14(23)18-16(22)20-21/h2-7H,1H3,(H,18,20,23) |
| InChIKey | HXCCUHDYPWIIHG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|