About 2-piperidin-4-yl-1,3-thiazol-5-amine
2-piperidin-4-yl-1,3-thiazol-5-amine (PubChem CID 172992650) has the molecular formula C8H13N3S
and a molecular weight of 183.28 g/mol. Its IUPAC name is 2-piperidin-4-yl-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 2-piperidin-4-yl-1,3-thiazol-5-amine |
| PubChem CID | 172992650 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-piperidin-4-yl-1,3-thiazol-5-amine |
| SMILES | Nc1cnc(C2CCNCC2)s1 |
| InChI | InChI=1S/C8H13N3S/c9-7-5-11-8(12-7)6-1-3-10-4-2-6/h5-6,10H,1-4,9H2 |
| InChIKey | ZFCLUBQICDPOMF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperidin-4-yl-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-yl-1,3-thiazol-5-amine?
The IUPAC name of 2-piperidin-4-yl-1,3-thiazol-5-amine (CID 172992650) is 2-piperidin-4-yl-1,3-thiazol-5-amine.
What is the SMILES notation for 2-piperidin-4-yl-1,3-thiazol-5-amine?
The canonical SMILES for 2-piperidin-4-yl-1,3-thiazol-5-amine is Nc1cnc(C2CCNCC2)s1.
What is the InChIKey of 2-piperidin-4-yl-1,3-thiazol-5-amine?
The InChIKey is ZFCLUBQICDPOMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S/c9-7-5-11-8(12-7)6-1-3-10-4-2-6/h5-6,10H,1-4,9H2.
What are the key properties of 2-piperidin-4-yl-1,3-thiazol-5-amine?
2-piperidin-4-yl-1,3-thiazol-5-amine has a molecular weight of 183.28 g/mol, XLogP of 1.19, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-yl-1,3-thiazol-5-amine is sourced from PubChem (CID 172992650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).