C11H8BrF3N2 — CID 172992944
4-bromo-1-methyl-2-[4-(trifluoromethyl)phenyl]imidazole (PubChem CID 172992944) has the molecular formula C11H8BrF3N2 and a molecular weight of 305.10 g/mol. Its IUPAC name is 4-bromo-1-methyl-2-[4-(trifluoromethyl)phenyl]imidazole.
| Compound Name | 4-bromo-1-methyl-2-[4-(trifluoromethyl)phenyl]imidazole |
|---|---|
| PubChem CID | 172992944 |
| Molecular Formula | C11H8BrF3N2 |
| Molecular Weight | 305.10 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 4-bromo-1-methyl-2-[4-(trifluoromethyl)phenyl]imidazole |
| SMILES | Cn1cc(Br)nc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H8BrF3N2/c1-17-6-9(12)16-10(17)7-2-4-8(5-3-7)11(13,14)15/h2-6H,1H3 |
| InChIKey | DFQYWIWGPUIIHM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.10 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |