C7H9Br2N3O — CID 172993131
4,5-dibromo-2-(oxan-2-yl)triazole (PubChem CID 172993131) has the molecular formula C7H9Br2N3O and a molecular weight of 310.98 g/mol. Its IUPAC name is 4,5-dibromo-2-(oxan-2-yl)triazole.
| Compound Name | 4,5-dibromo-2-(oxan-2-yl)triazole |
|---|---|
| PubChem CID | 172993131 |
| Molecular Formula | C7H9Br2N3O |
| Molecular Weight | 310.98 g/mol |
| Exact Mass | 308.91 |
| IUPAC Name | 4,5-dibromo-2-(oxan-2-yl)triazole |
| SMILES | Brc1nn(C2CCCCO2)nc1Br |
| InChI | InChI=1S/C7H9Br2N3O/c8-6-7(9)11-12(10-6)5-3-1-2-4-13-5/h5H,1-4H2 |
| InChIKey | RBZNQZIHYUWPPX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.98 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |