About 4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine
4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine (PubChem CID 172993652) has the molecular formula C6H5BrN4S
and a molecular weight of 245.11 g/mol. Its IUPAC name is 4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine.
Molecular Properties
| Compound Name | 4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine |
| PubChem CID | 172993652 |
| Molecular Formula | C6H5BrN4S |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 243.94 |
| IUPAC Name | 4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine |
| SMILES | Nc1nc(Br)cn1-c1cscn1 |
| InChI | InChI=1S/C6H5BrN4S/c7-4-1-11(6(8)10-4)5-2-12-3-9-5/h1-3H,(H2,8,10) |
| InChIKey | JIFSTJSHQYIDOM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine?
The IUPAC name of 4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine (CID 172993652) is 4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine.
What is the SMILES notation for 4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine?
The canonical SMILES for 4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine is Nc1nc(Br)cn1-c1cscn1.
What is the InChIKey of 4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine?
The InChIKey is JIFSTJSHQYIDOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrN4S/c7-4-1-11(6(8)10-4)5-2-12-3-9-5/h1-3H,(H2,8,10).
What are the key properties of 4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine?
4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine has a molecular weight of 245.11 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-(1,3-thiazol-4-yl)imidazol-2-amine is sourced from PubChem (CID 172993652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).