About ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate
ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate (PubChem CID 172994165) has the molecular formula C13H15N3O2
and a molecular weight of 245.28 g/mol. Its IUPAC name is ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate |
| PubChem CID | 172994165 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate |
| SMILES | CCOC(=O)Cn1nc(-c2ccccc2)nc1C |
| InChI | InChI=1S/C13H15N3O2/c1-3-18-12(17)9-16-10(2)14-13(15-16)11-7-5-4-6-8-11/h4-8H,3,9H2,1-2H3 |
| InChIKey | YSAIOTKNYXOKQF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate?
The IUPAC name of ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate (CID 172994165) is ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate.
What is the SMILES notation for ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate?
The canonical SMILES for ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate is CCOC(=O)Cn1nc(-c2ccccc2)nc1C.
What is the InChIKey of ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate?
The InChIKey is YSAIOTKNYXOKQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2/c1-3-18-12(17)9-16-10(2)14-13(15-16)11-7-5-4-6-8-11/h4-8H,3,9H2,1-2H3.
What are the key properties of ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate?
ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate has a molecular weight of 245.28 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(5-methyl-3-phenyl-1,2,4-triazol-1-yl)acetate is sourced from PubChem (CID 172994165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).