C17H14ClN3OS — CID 172994219
4-(2-chloroquinolin-3-yl)-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one (PubChem CID 172994219) has the molecular formula C17H14ClN3OS and a molecular weight of 343.84 g/mol. Its IUPAC name is 4-(2-chloroquinolin-3-yl)-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one.
| Compound Name | 4-(2-chloroquinolin-3-yl)-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one |
|---|---|
| PubChem CID | 172994219 |
| Molecular Formula | C17H14ClN3OS |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 4-(2-chloroquinolin-3-yl)-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one |
| SMILES | O=C1CCCC2=C1C(c1cc3ccccc3nc1Cl)NC(=S)N2 |
| InChI | InChI=1S/C17H14ClN3OS/c18-16-10(8-9-4-1-2-5-11(9)19-16)15-14-12(20-17(23)21-15)6-3-7-13(14)22/h1-2,4-5,8,15H,3,6-7H2,(H2,20,21,23) |
| InChIKey | BPIJIHQKVNTLAU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|