C17H25Cl2N3O — CID 172994328
1-(6-amino-3-pyridinyl)-2-[(1,1,1,2,3,3-hexadeuterio-4-phenylbutan-2-yl)amino]ethanol;dihydrochloride (PubChem CID 172994328) has the molecular formula C17H25Cl2N3O and a molecular weight of 364.35 g/mol. Its IUPAC name is 1-(6-amino-3-pyridinyl)-2-[(1,1,1,2,3,3-hexadeuterio-4-phenylbutan-2-yl)amino]ethanol;dihydrochloride.
| Compound Name | 1-(6-amino-3-pyridinyl)-2-[(1,1,1,2,3,3-hexadeuterio-4-phenylbutan-2-yl)amino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 172994328 |
| Molecular Formula | C17H25Cl2N3O |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-(6-amino-3-pyridinyl)-2-[(1,1,1,2,3,3-hexadeuterio-4-phenylbutan-2-yl)amino]ethanol;dihydrochloride |
| SMILES | Cl.Cl.[2H]C([2H])([2H])C([2H])(NCC(O)c1ccc(N)nc1)C([2H])([2H])Cc1ccccc1 |
| InChI | InChI=1S/C17H23N3O.2ClH/c1-13(7-8-14-5-3-2-4-6-14)19-12-16(21)15-9-10-17(18)20-11-15;;/h2-6,9-11,13,16,19,21H,7-8,12H2,1H3,(H2,18,20);2*1H/i1D3,7D2,13D;; |
| InChIKey | LEJTZDSAXXWOLE-OPQUJPTASA-N |
| XLogP | 3.15 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |