C32H48N4O12S2 — CID 172994787
4-[2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl-dimethylazaniumyl]butane-1-sulfonate (PubChem CID 172994787) has the molecular formula C32H48N4O12S2 and a molecular weight of 744.89 g/mol. Its IUPAC name is 4-[2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl-dimethylazaniumyl]butane-1-sulfonate.
| Compound Name | 4-[2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl-dimethylazaniumyl]butane-1-sulfonate |
|---|---|
| PubChem CID | 172994787 |
| Molecular Formula | C32H48N4O12S2 |
| Molecular Weight | 744.89 g/mol |
| Exact Mass | 744.27 |
| IUPAC Name | 4-[2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl-dimethylazaniumyl]butane-1-sulfonate |
| SMILES | C[N+](C)(CCCCS(=O)(=O)[O-])CCN1C(=O)[C@@H]2C3C=CC(O3)[C@@H]2C1=O.C[N+](C)(CCCCS(=O)(=O)[O-])CCN1C(=O)[C@@H]2C3C=CC(O3)[C@@H]2C1=O |
| InChI | InChI=1S/2C16H24N2O6S/c2*1-18(2,8-3-4-10-25(21,22)23)9-7-17-15(19)13-11-5-6-12(24-11)14(13)16(17)20/h2*5-6,11-14H,3-4,7-10H2,1-2H3/t2*11?,12?,13-,14+ |
| InChIKey | BRQSOFBZOUEYTP-PYDFAJSNSA-N |
| XLogP | -1.35 |
| TPSA | 207.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.89 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|