C17H17N7O — CID 172994889
5-cyclopropyl-1-(4-methylphenyl)-N'-pyrimidin-2-yltriazole-4-carbohydrazide (PubChem CID 172994889) has the molecular formula C17H17N7O and a molecular weight of 335.37 g/mol. Its IUPAC name is 5-cyclopropyl-1-(4-methylphenyl)-N'-pyrimidin-2-yltriazole-4-carbohydrazide.
| Compound Name | 5-cyclopropyl-1-(4-methylphenyl)-N'-pyrimidin-2-yltriazole-4-carbohydrazide |
|---|---|
| PubChem CID | 172994889 |
| Molecular Formula | C17H17N7O |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 5-cyclopropyl-1-(4-methylphenyl)-N'-pyrimidin-2-yltriazole-4-carbohydrazide |
| SMILES | Cc1ccc(-n2nnc(C(=O)NNc3ncccn3)c2C2CC2)cc1 |
| InChI | InChI=1S/C17H17N7O/c1-11-3-7-13(8-4-11)24-15(12-5-6-12)14(20-23-24)16(25)21-22-17-18-9-2-10-19-17/h2-4,7-10,12H,5-6H2,1H3,(H,21,25)(H,18,19,22) |
| InChIKey | BUYXNSRTFMZIDQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|