sodium;hydride;hydroxymethanesulfinic acid

CH5NaO3S — CID 172995040

IUPACsodium;hydride;hydroxymethanesulfinic acid
SMILESO=S(O)CO.[H-].[Na+]
InChIInChI=1S/CH4O3S.Na.H/c2-1-5(3)4;;/h2H,1H2,(H,3,4);;/q;+1;-1
InChIKeyXEEDWSLZFOTMSI-UHFFFAOYSA-N
MW120.10 g/mol
LogP-3.73
Rot. Bonds1

About sodium;hydride;hydroxymethanesulfinic acid

sodium;hydride;hydroxymethanesulfinic acid (PubChem CID 172995040) has the molecular formula CH5NaO3S and a molecular weight of 120.10 g/mol. Its IUPAC name is sodium;hydride;hydroxymethanesulfinic acid.

Molecular Properties

Compound Namesodium;hydride;hydroxymethanesulfinic acid
PubChem CID172995040
Molecular FormulaCH5NaO3S
Molecular Weight120.10 g/mol
Exact Mass119.99
IUPAC Namesodium;hydride;hydroxymethanesulfinic acid
SMILESO=S(O)CO.[H-].[Na+]
InChIInChI=1S/CH4O3S.Na.H/c2-1-5(3)4;;/h2H,1H2,(H,3,4);;/q;+1;-1
InChIKeyXEEDWSLZFOTMSI-UHFFFAOYSA-N
XLogP-3.73
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500120.10
LogP ≤ 5-3.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze sodium;hydride;hydroxymethanesulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium;hydride;hydroxymethanesulfinic acid?
The IUPAC name of sodium;hydride;hydroxymethanesulfinic acid (CID 172995040) is sodium;hydride;hydroxymethanesulfinic acid.
What is the SMILES notation for sodium;hydride;hydroxymethanesulfinic acid?
The canonical SMILES for sodium;hydride;hydroxymethanesulfinic acid is O=S(O)CO.[H-].[Na+].
What is the InChIKey of sodium;hydride;hydroxymethanesulfinic acid?
The InChIKey is XEEDWSLZFOTMSI-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4O3S.Na.H/c2-1-5(3)4;;/h2H,1H2,(H,3,4);;/q;+1;-1.
What are the key properties of sodium;hydride;hydroxymethanesulfinic acid?
sodium;hydride;hydroxymethanesulfinic acid has a molecular weight of 120.10 g/mol, XLogP of -3.73, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;hydroxymethanesulfinic acid is sourced from PubChem (CID 172995040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).