About 3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine
3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine (PubChem CID 172995512) has the molecular formula C11H20FN3
and a molecular weight of 213.30 g/mol. Its IUPAC name is 3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine.
Molecular Properties
| Compound Name | 3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine |
| PubChem CID | 172995512 |
| Molecular Formula | C11H20FN3 |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine |
| SMILES | C/N=C(\C)C(C[C@H]1C[C@@H](F)CN1)=C(C)N |
| InChI | InChI=1S/C11H20FN3/c1-7(13)11(8(2)14-3)5-10-4-9(12)6-15-10/h9-10,15H,4-6,13H2,1-3H3/b11-7?,14-8+/t9-,10-/m1/s1 |
| InChIKey | IPQHHRRTWDSRIJ-HKWWNNCDSA-N |
| XLogP | 1.40 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine?
The IUPAC name of 3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine (CID 172995512) is 3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine.
What is the SMILES notation for 3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine?
The canonical SMILES for 3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine is C/N=C(\C)C(C[C@H]1C[C@@H](F)CN1)=C(C)N.
What is the InChIKey of 3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine?
The InChIKey is IPQHHRRTWDSRIJ-HKWWNNCDSA-N. The full InChI is InChI=1S/C11H20FN3/c1-7(13)11(8(2)14-3)5-10-4-9(12)6-15-10/h9-10,15H,4-6,13H2,1-3H3/b11-7?,14-8+/t9-,10-/m1/s1.
What are the key properties of 3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine?
3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine has a molecular weight of 213.30 g/mol, XLogP of 1.40, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2S,4R)-4-fluoropyrrolidin-2-yl]methyl]-4-methyliminopent-2-en-2-amine is sourced from PubChem (CID 172995512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).