C20H37N5O15S6Si2 — CID 172995520
N-[1-[7-[bis[2-tris(methylsulfonyl)silylethoxymethyl]amino]pyrazolo[1,5-a]pyrimidin-5-yl]ethylidene]hydroxylamine (PubChem CID 172995520) has the molecular formula C20H37N5O15S6Si2 and a molecular weight of 836.11 g/mol. Its IUPAC name is N-[1-[7-[bis[2-tris(methylsulfonyl)silylethoxymethyl]amino]pyrazolo[1,5-a]pyrimidin-5-yl]ethylidene]hydroxylamine.
| Compound Name | N-[1-[7-[bis[2-tris(methylsulfonyl)silylethoxymethyl]amino]pyrazolo[1,5-a]pyrimidin-5-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 172995520 |
| Molecular Formula | C20H37N5O15S6Si2 |
| Molecular Weight | 836.11 g/mol |
| Exact Mass | 835.01 |
| IUPAC Name | N-[1-[7-[bis[2-tris(methylsulfonyl)silylethoxymethyl]amino]pyrazolo[1,5-a]pyrimidin-5-yl]ethylidene]hydroxylamine |
| SMILES | CC(=NO)c1cc(N(COCC[Si](S(C)(=O)=O)(S(C)(=O)=O)S(C)(=O)=O)COCC[Si](S(C)(=O)=O)(S(C)(=O)=O)S(C)(=O)=O)n2nccc2n1 |
| InChI | InChI=1S/C20H37N5O15S6Si2/c1-17(23-26)18-14-20(25-19(22-18)8-9-21-25)24(15-39-10-12-47(41(2,27)28,42(3,29)30)43(4,31)32)16-40-11-13-48(44(5,33)34,45(6,35)36)46(7,37)38/h8-9,14,26H,10-13,15-16H2,1-7H3 |
| InChIKey | PSGYECAYSUPGPP-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 289.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.11 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|