About calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride
calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride (PubChem CID 172997704) has the molecular formula C12H15CaI3N2O2
and a molecular weight of 640.05 g/mol. Its IUPAC name is calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride.
Molecular Properties
| Compound Name | calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride |
| PubChem CID | 172997704 |
| Molecular Formula | C12H15CaI3N2O2 |
| Molecular Weight | 640.05 g/mol |
| Exact Mass | 639.79 |
| IUPAC Name | calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride |
| SMILES | CN(C)/C=N/c1c(I)cc(I)c(CCC(=O)O)c1I.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C12H13I3N2O2.Ca.2H/c1-17(2)6-16-12-9(14)5-8(13)7(11(12)15)3-4-10(18)19;;;/h5-6H,3-4H2,1-2H3,(H,18,19);;;/q;+2;2*-1/b16-6+;;; |
| InChIKey | DEVLUXHQIHEFGD-CETSFZMCSA-N |
| XLogP | 3.58 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 640.05 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride?
The IUPAC name of calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride (CID 172997704) is calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride.
What is the SMILES notation for calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride?
The canonical SMILES for calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride is CN(C)/C=N/c1c(I)cc(I)c(CCC(=O)O)c1I.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride?
The InChIKey is DEVLUXHQIHEFGD-CETSFZMCSA-N. The full InChI is InChI=1S/C12H13I3N2O2.Ca.2H/c1-17(2)6-16-12-9(14)5-8(13)7(11(12)15)3-4-10(18)19;;;/h5-6H,3-4H2,1-2H3,(H,18,19);;;/q;+2;2*-1/b16-6+;;;.
What are the key properties of calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride?
calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride has a molecular weight of 640.05 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride is sourced from PubChem (CID 172997704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).