About calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride
calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride (PubChem CID 172998088) has the molecular formula C14H14CaN4O5
and a molecular weight of 358.37 g/mol. Its IUPAC name is calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride.
Molecular Properties
| Compound Name | calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride |
| PubChem CID | 172998088 |
| Molecular Formula | C14H14CaN4O5 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride |
| SMILES | Cn1cnc2c1c(=O)n(OC(=O)c1ccccc1O)c(=O)n2C.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C14H12N4O5.Ca.2H/c1-16-7-15-11-10(16)12(20)18(14(22)17(11)2)23-13(21)8-5-3-4-6-9(8)19;;;/h3-7,19H,1-2H3;;;/q;+2;2*-1 |
| InChIKey | YDCXZEOIZVIBIG-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride?
The IUPAC name of calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride (CID 172998088) is calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride.
What is the SMILES notation for calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride?
The canonical SMILES for calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride is Cn1cnc2c1c(=O)n(OC(=O)c1ccccc1O)c(=O)n2C.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride?
The InChIKey is YDCXZEOIZVIBIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O5.Ca.2H/c1-16-7-15-11-10(16)12(20)18(14(22)17(11)2)23-13(21)8-5-3-4-6-9(8)19;;;/h3-7,19H,1-2H3;;;/q;+2;2*-1.
What are the key properties of calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride?
calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride has a molecular weight of 358.37 g/mol, XLogP of -0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;(3,7-dimethyl-2,6-dioxopurin-1-yl) 2-hydroxybenzoate;hydride is sourced from PubChem (CID 172998088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).