About 1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol
1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol (PubChem CID 172999182) has the molecular formula C5H9N3O2
and a molecular weight of 143.15 g/mol. Its IUPAC name is 1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol.
Molecular Properties
| Compound Name | 1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol |
| PubChem CID | 172999182 |
| Molecular Formula | C5H9N3O2 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol |
| SMILES | Cc1noc(NC(C)O)n1 |
| InChI | InChI=1S/C5H9N3O2/c1-3-6-5(10-8-3)7-4(2)9/h4,9H,1-2H3,(H,6,7,8) |
| InChIKey | IRJWHKWKQSEKHM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol?
The IUPAC name of 1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol (CID 172999182) is 1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol.
What is the SMILES notation for 1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol?
The canonical SMILES for 1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol is Cc1noc(NC(C)O)n1.
What is the InChIKey of 1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol?
The InChIKey is IRJWHKWKQSEKHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O2/c1-3-6-5(10-8-3)7-4(2)9/h4,9H,1-2H3,(H,6,7,8).
What are the key properties of 1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol?
1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol has a molecular weight of 143.15 g/mol, XLogP of 0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]ethanol is sourced from PubChem (CID 172999182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).