About 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride
2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride (PubChem CID 172999610) has the molecular formula C15H12Cl2O5
and a molecular weight of 343.16 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride |
| PubChem CID | 172999610 |
| Molecular Formula | C15H12Cl2O5 |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride |
| SMILES | Cl.Oc1ccc(-c2[o+]c3cc(O)cc(O)c3cc2O)cc1.[Cl-] |
| InChI | InChI=1S/C15H10O5.2ClH/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15;;/h1-7H,(H3-,16,17,18,19);2*1H |
| InChIKey | QLXAQQFBUVBMTF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 92.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride?
The IUPAC name of 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride (CID 172999610) is 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride.
What is the SMILES notation for 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride?
The canonical SMILES for 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride is Cl.Oc1ccc(-c2[o+]c3cc(O)cc(O)c3cc2O)cc1.[Cl-].
What is the InChIKey of 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride?
The InChIKey is QLXAQQFBUVBMTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O5.2ClH/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15;;/h1-7H,(H3-,16,17,18,19);2*1H.
What are the key properties of 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride?
2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride has a molecular weight of 343.16 g/mol, XLogP of 0.63, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)chromenylium-3,5,7-triol;chloride;hydrochloride is sourced from PubChem (CID 172999610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).