About 5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide
5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide (PubChem CID 172999747) has the molecular formula C7H10N2O2S
and a molecular weight of 186.24 g/mol. Its IUPAC name is 5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide |
| PubChem CID | 172999747 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide |
| SMILES | CC(C)NC(=O)c1cc(=O)s[nH]1 |
| InChI | InChI=1S/C7H10N2O2S/c1-4(2)8-7(11)5-3-6(10)12-9-5/h3-4,9H,1-2H3,(H,8,11) |
| InChIKey | CGBIZYXRWBBGBA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide?
The IUPAC name of 5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide (CID 172999747) is 5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide.
What is the SMILES notation for 5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide?
The canonical SMILES for 5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide is CC(C)NC(=O)c1cc(=O)s[nH]1.
What is the InChIKey of 5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide?
The InChIKey is CGBIZYXRWBBGBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-4(2)8-7(11)5-3-6(10)12-9-5/h3-4,9H,1-2H3,(H,8,11).
What are the key properties of 5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide?
5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide has a molecular weight of 186.24 g/mol, XLogP of 0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-N-propan-2-yl-2H-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 172999747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).