About N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide
N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide (PubChem CID 172999878) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide |
| PubChem CID | 172999878 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide |
| SMILES | CCNC(=O)c1cc(=O)s[nH]1 |
| InChI | InChI=1S/C6H8N2O2S/c1-2-7-6(10)4-3-5(9)11-8-4/h3,8H,2H2,1H3,(H,7,10) |
| InChIKey | PPIBJFKNOMWBLI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide?
The IUPAC name of N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide (CID 172999878) is N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide.
What is the SMILES notation for N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide?
The canonical SMILES for N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide is CCNC(=O)c1cc(=O)s[nH]1.
What is the InChIKey of N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide?
The InChIKey is PPIBJFKNOMWBLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-2-7-6(10)4-3-5(9)11-8-4/h3,8H,2H2,1H3,(H,7,10).
What are the key properties of N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide?
N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide has a molecular weight of 172.21 g/mol, XLogP of 0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-oxo-2H-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 172999878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).