About hydron;2-methylprop-2-enoate
hydron;2-methylprop-2-enoate (PubChem CID 173000318) has the molecular formula C4H6O2
and a molecular weight of 86.09 g/mol. Its IUPAC name is hydron;2-methylprop-2-enoate.
Molecular Properties
| Compound Name | hydron;2-methylprop-2-enoate |
| PubChem CID | 173000318 |
| Molecular Formula | C4H6O2 |
| Molecular Weight | 86.09 g/mol |
| Exact Mass | 86.04 |
| IUPAC Name | hydron;2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)[O-].[H+] |
| InChI | InChI=1S/C4H6O2/c1-3(2)4(5)6/h1H2,2H3,(H,5,6) |
| InChIKey | CERQOIWHTDAKMF-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.09 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hydron;2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;2-methylprop-2-enoate?
The IUPAC name of hydron;2-methylprop-2-enoate (CID 173000318) is hydron;2-methylprop-2-enoate.
What is the SMILES notation for hydron;2-methylprop-2-enoate?
The canonical SMILES for hydron;2-methylprop-2-enoate is C=C(C)C(=O)[O-].[H+].
What is the InChIKey of hydron;2-methylprop-2-enoate?
The InChIKey is CERQOIWHTDAKMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2/c1-3(2)4(5)6/h1H2,2H3,(H,5,6).
What are the key properties of hydron;2-methylprop-2-enoate?
hydron;2-methylprop-2-enoate has a molecular weight of 86.09 g/mol, XLogP of -0.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;2-methylprop-2-enoate is sourced from PubChem (CID 173000318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).