About benzene;ruthenium;1,2,3,4-tetrachlorobenzene
benzene;ruthenium;1,2,3,4-tetrachlorobenzene (PubChem CID 173000636) has the molecular formula C12H8Cl4Ru2
and a molecular weight of 496.15 g/mol. Its IUPAC name is benzene;ruthenium;1,2,3,4-tetrachlorobenzene.
Molecular Properties
| Compound Name | benzene;ruthenium;1,2,3,4-tetrachlorobenzene |
| PubChem CID | 173000636 |
| Molecular Formula | C12H8Cl4Ru2 |
| Molecular Weight | 496.15 g/mol |
| Exact Mass | 495.75 |
| IUPAC Name | benzene;ruthenium;1,2,3,4-tetrachlorobenzene |
| SMILES | Clc1ccc(Cl)c(Cl)c1Cl.[Ru].[Ru].c1ccccc1 |
| InChI | InChI=1S/C6H2Cl4.C6H6.2Ru/c7-3-1-2-4(8)6(10)5(3)9;1-2-4-6-5-3-1;;/h1-2H;1-6H;; |
| InChIKey | UDKYUKABOTUERC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.15 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze benzene;ruthenium;1,2,3,4-tetrachlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;ruthenium;1,2,3,4-tetrachlorobenzene?
The IUPAC name of benzene;ruthenium;1,2,3,4-tetrachlorobenzene (CID 173000636) is benzene;ruthenium;1,2,3,4-tetrachlorobenzene.
What is the SMILES notation for benzene;ruthenium;1,2,3,4-tetrachlorobenzene?
The canonical SMILES for benzene;ruthenium;1,2,3,4-tetrachlorobenzene is Clc1ccc(Cl)c(Cl)c1Cl.[Ru].[Ru].c1ccccc1.
What is the InChIKey of benzene;ruthenium;1,2,3,4-tetrachlorobenzene?
The InChIKey is UDKYUKABOTUERC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Cl4.C6H6.2Ru/c7-3-1-2-4(8)6(10)5(3)9;1-2-4-6-5-3-1;;/h1-2H;1-6H;;.
What are the key properties of benzene;ruthenium;1,2,3,4-tetrachlorobenzene?
benzene;ruthenium;1,2,3,4-tetrachlorobenzene has a molecular weight of 496.15 g/mol, XLogP of 5.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;ruthenium;1,2,3,4-tetrachlorobenzene is sourced from PubChem (CID 173000636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).