About 2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine
2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine (PubChem CID 173000729) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine |
| PubChem CID | 173000729 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine |
| SMILES | CC(CN(C)C)OC1=CCCC=C1 |
| InChI | InChI=1S/C11H19NO/c1-10(9-12(2)3)13-11-7-5-4-6-8-11/h5,7-8,10H,4,6,9H2,1-3H3 |
| InChIKey | URDQZQOVCNCZLY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine?
The IUPAC name of 2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine (CID 173000729) is 2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine?
The canonical SMILES for 2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine is CC(CN(C)C)OC1=CCCC=C1.
What is the InChIKey of 2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine?
The InChIKey is URDQZQOVCNCZLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-10(9-12(2)3)13-11-7-5-4-6-8-11/h5,7-8,10H,4,6,9H2,1-3H3.
What are the key properties of 2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine?
2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine has a molecular weight of 181.28 g/mol, XLogP of 2.19, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,5-dien-1-yloxy-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 173000729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).