About 3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine
3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine (PubChem CID 173000734) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine.
Molecular Properties
| Compound Name | 3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine |
| PubChem CID | 173000734 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine |
| SMILES | CN1CCC(OC2=CCCC=C2)C1 |
| InChI | InChI=1S/C11H17NO/c1-12-8-7-11(9-12)13-10-5-3-2-4-6-10/h3,5-6,11H,2,4,7-9H2,1H3 |
| InChIKey | ZSVLXKUWSFNBSM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine?
The IUPAC name of 3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine (CID 173000734) is 3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine.
What is the SMILES notation for 3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine?
The canonical SMILES for 3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine is CN1CCC(OC2=CCCC=C2)C1.
What is the InChIKey of 3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine?
The InChIKey is ZSVLXKUWSFNBSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-12-8-7-11(9-12)13-10-5-3-2-4-6-10/h3,5-6,11H,2,4,7-9H2,1H3.
What are the key properties of 3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine?
3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine has a molecular weight of 179.26 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,5-dien-1-yloxy-1-methylpyrrolidine is sourced from PubChem (CID 173000734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).