About [2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride
[2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride (PubChem CID 173000827) has the molecular formula C17H17Cl2N2O3P
and a molecular weight of 399.21 g/mol. Its IUPAC name is [2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride.
Molecular Properties
| Compound Name | [2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride |
| PubChem CID | 173000827 |
| Molecular Formula | C17H17Cl2N2O3P |
| Molecular Weight | 399.21 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | [2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride |
| SMILES | Cl.O=P(O)(O)Cc1ccccc1-[n+]1ccc(-c2ccncc2)cc1.[Cl-] |
| InChI | InChI=1S/C17H15N2O3P.2ClH/c20-23(21,22)13-16-3-1-2-4-17(16)19-11-7-15(8-12-19)14-5-9-18-10-6-14;;/h1-12H,13H2,(H-,20,21,22);2*1H |
| InChIKey | CTALJABFQVFQOH-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 74.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride?
The IUPAC name of [2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride (CID 173000827) is [2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride.
What is the SMILES notation for [2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride?
The canonical SMILES for [2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride is Cl.O=P(O)(O)Cc1ccccc1-[n+]1ccc(-c2ccncc2)cc1.[Cl-].
What is the InChIKey of [2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride?
The InChIKey is CTALJABFQVFQOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N2O3P.2ClH/c20-23(21,22)13-16-3-1-2-4-17(16)19-11-7-15(8-12-19)14-5-9-18-10-6-14;;/h1-12H,13H2,(H-,20,21,22);2*1H.
What are the key properties of [2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride?
[2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride has a molecular weight of 399.21 g/mol, XLogP of 0.13, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-pyridin-4-ylpyridin-1-ium-1-yl)phenyl]methylphosphonic acid;chloride;hydrochloride is sourced from PubChem (CID 173000827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).