About sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride
sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride (PubChem CID 173001077) has the molecular formula C12H14I3N2NaO2
and a molecular weight of 621.96 g/mol. Its IUPAC name is sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride.
Molecular Properties
| Compound Name | sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride |
| PubChem CID | 173001077 |
| Molecular Formula | C12H14I3N2NaO2 |
| Molecular Weight | 621.96 g/mol |
| Exact Mass | 621.81 |
| IUPAC Name | sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride |
| SMILES | CN(C)/C=N/c1c(I)cc(I)c(CCC(=O)O)c1I.[H-].[Na+] |
| InChI | InChI=1S/C12H13I3N2O2.Na.H/c1-17(2)6-16-12-9(14)5-8(13)7(11(12)15)3-4-10(18)19;;/h5-6H,3-4H2,1-2H3,(H,18,19);;/q;+1;-1/b16-6+;; |
| InChIKey | USULRPQTRCZIGP-HEFZRFOPSA-N |
| XLogP | 0.86 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 621.96 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride?
The IUPAC name of sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride (CID 173001077) is sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride.
What is the SMILES notation for sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride?
The canonical SMILES for sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride is CN(C)/C=N/c1c(I)cc(I)c(CCC(=O)O)c1I.[H-].[Na+].
What is the InChIKey of sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride?
The InChIKey is USULRPQTRCZIGP-HEFZRFOPSA-N. The full InChI is InChI=1S/C12H13I3N2O2.Na.H/c1-17(2)6-16-12-9(14)5-8(13)7(11(12)15)3-4-10(18)19;;/h5-6H,3-4H2,1-2H3,(H,18,19);;/q;+1;-1/b16-6+;;.
What are the key properties of sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride?
sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride has a molecular weight of 621.96 g/mol, XLogP of 0.86, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-[3-(dimethylaminomethylideneamino)-2,4,6-triiodophenyl]propanoic acid;hydride is sourced from PubChem (CID 173001077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).